CAS 1016819-25-2 is the registry number for 4-Chloro-6-ethylquinoline-3-carbonitrile, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-6-ethylquinoline-3-carbonitrile (CAS 1016819-25-2) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 4-chloro-6-ethylquinoline-3-carbonitrile. InChIKey: FNWNRWUDNWMSHD-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-chloro-6-ethylquinoline-3-carbonitrile |
| InChIKey | FNWNRWUDNWMSHD-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C(=CN=C2C=C1)C#N)Cl |
Computed by PubChem (NCBI)