CAS 3829-86-5 appears in our catalog under these names: 1,10-Phenanthroline hydrochloride 99%, 1,10-Phenanthroline hydrochloride, monohydrate, min. 99 %, p.a., 5 g, glass, 1,10-Phenanthroline hydrochloride, monohydrate, min. 99 %, p.a., 10 g, glass, 1,10-Phenanthroline hydrochloride, monohydrate, min. 99 %, p.a., 50 g, glass, 1,10-Phenanthroline hydrochloride, 97%. Offered by: Ambeed, Roth, Fluorochem. Available pack sizes: 25g, 100g, 500g, 5g, 10g, 50g.
1,10-phenanthroline;hydrochloride (CAS 3829-86-5) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 1,10-phenanthroline;hydrochloride. InChIKey: QPXDKQBBJCTNOY-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 1,10-phenanthroline;hydrochloride |
| InChIKey | QPXDKQBBJCTNOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl |
Computed by PubChem (NCBI)