CAS 25823-50-1 is the registry number for 3-Chloro-5,6-dihydrobenzo[h]cinnoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5,6-dihydrobenzo[h]cinnoline (CAS 25823-50-1) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 3-chloro-5,6-dihydrobenzo[h]cinnoline. InChIKey: AWCLLRQTVFHVBY-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 3-chloro-5,6-dihydrobenzo[h]cinnoline |
| InChIKey | AWCLLRQTVFHVBY-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=NN=C2C3=CC=CC=C31)Cl |
Computed by PubChem (NCBI)