CAS 702670-49-3 is the registry number for 1-(2-Chlorobenzyl)-1H-pyrrole-2-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2-chlorophenyl)methyl]pyrrole-2-carbonitrile (CAS 702670-49-3) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]pyrrole-2-carbonitrile. InChIKey: ALLWJFJGIGYZKA-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]pyrrole-2-carbonitrile |
| InChIKey | ALLWJFJGIGYZKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=CC=C2C#N)Cl |
Computed by PubChem (NCBI)