Products 1016837-36-7
CAS 1016837-36-7 appears in our catalog under these names: 4-Piperidinone,1-(5-bromo-2-pyridinyl)-, 97%, 97%, 1-(5-Bromopyridin-2-yl)piperidin-4-one, 97%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
1-(5-bromo-2-pyridinyl)piperidin-4-one (CAS 1016837-36-7) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperidin-4-one. InChIKey: QXJXKIOWKTVJRS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperidin-4-one |
| InChIKey | QXJXKIOWKTVJRS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)