CAS 1016856-86-2 is the registry number for 3-(Aminomethyl)-N-(2,2,2-trifluoroethyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(aminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide (CAS 1016856-86-2) is a chemical compound with the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. IUPAC name: 3-(aminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide. InChIKey: RISKWTRJFKAPLS-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2S |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-(aminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| InChIKey | RISKWTRJFKAPLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NCC(F)(F)F)CN |
Computed by PubChem (NCBI)