CAS 848178-44-9 appears in our catalog under these names: 4-([(2,2,2-Trifluoroethyl)amino]methyl)benzene-1-sulfonamide, 95%, 4-{((2,2,2-trifluoroethyl)amino)methyl}benzene-1-sulfonamide, 95%, 4-{((2,2,2-Trifluoroethyl)amino)methyl}benzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 2,5g.
4-[(2,2,2-trifluoroethylamino)methyl]benzenesulfonamide (CAS 848178-44-9) is a chemical compound with the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. IUPAC name: 4-[(2,2,2-trifluoroethylamino)methyl]benzenesulfonamide. InChIKey: HDSKWXVELRSKAX-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2S |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 4-[(2,2,2-trifluoroethylamino)methyl]benzenesulfonamide |
| InChIKey | HDSKWXVELRSKAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNCC(F)(F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)