CAS 917096-84-5 is the registry number for N-(2-AMINOETHYL)-4-(TRIFLUOROMETHYL)BENZ. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.
N-(2-aminoethyl)-4-(trifluoromethyl)benzenesulfonamide (CAS 917096-84-5) is a chemical compound with the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. IUPAC name: N-(2-aminoethyl)-4-(trifluoromethyl)benzenesulfonamide. InChIKey: HOVKSPHQQLXZON-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2S |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | N-(2-aminoethyl)-4-(trifluoromethyl)benzenesulfonamide |
| InChIKey | HOVKSPHQQLXZON-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)S(=O)(=O)NCCN |
Computed by PubChem (NCBI)