CAS 1016886-24-0 appears in our catalog under these names: 2-(3-Acetylphenoxy)-n,n-dimethylacetamide, 95%, 2-(3-Acetylphenoxy)-N,N-dimethylacetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(3-acetylphenoxy)-N,N-dimethylacetamide (CAS 1016886-24-0) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-(3-acetylphenoxy)-N,N-dimethylacetamide. InChIKey: IOABPQYQHMAXJL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-(3-acetylphenoxy)-N,N-dimethylacetamide |
| InChIKey | IOABPQYQHMAXJL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC(=O)N(C)C |
Computed by PubChem (NCBI)