CAS 1016886-27-3 is the registry number for 4-Isocyanato-1-methanesulfonylpiperidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-isocyanato-1-methylsulfonylpiperidine (CAS 1016886-27-3) is a chemical compound with the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. IUPAC name: 4-isocyanato-1-methylsulfonylpiperidine. InChIKey: DVRFZFNTDSRPOR-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O3S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 4-isocyanato-1-methylsulfonylpiperidine |
| InChIKey | DVRFZFNTDSRPOR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)N=C=O |
Computed by PubChem (NCBI)