CAS 1485538-81-5 is the registry number for N-((3,5-Dimethylisoxazol-4-yl)methyl)methanesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]methanesulfonamide (CAS 1485538-81-5) is a chemical compound with the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. IUPAC name: N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]methanesulfonamide. InChIKey: LWUYQJAPPJGBKL-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O3S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]methanesulfonamide |
| InChIKey | LWUYQJAPPJGBKL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CNS(=O)(=O)C |
Computed by PubChem (NCBI)