CAS 2059993-07-4 appears in our catalog under these names: Hexahydropyrido(1,2-d)(1,2,4)thiadiazin-4(3H)-one 2,2-dioxide, 95%, Hexahydropyrido(1,​2-​d)​(1,​2,​4)​thiadiazin-​4(3H)​-​one 2,​2-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-dioxo-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]thiadiazin-4-one (CAS 2059993-07-4) is a chemical compound with the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. IUPAC name: 2,2-dioxo-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]thiadiazin-4-one. InChIKey: FJDYYARJTYMDET-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O3S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 2,2-dioxo-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]thiadiazin-4-one |
| InChIKey | FJDYYARJTYMDET-UHFFFAOYSA-N |
| SMILES | C1CCN2C(C1)CS(=O)(=O)NC2=O |
Computed by PubChem (NCBI)