Products 84703-39-9
CAS 84703-39-9 is the registry number for 3-(1,1-Dioxido-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea (CAS 84703-39-9) is a chemical compound with the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. IUPAC name: 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea. InChIKey: UHOQIDMEZMQGLE-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O3S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea |
| InChIKey | UHOQIDMEZMQGLE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1CS(=O)(=O)C=C1 |
Computed by PubChem (NCBI)