Products 1017055-72-9
CAS 1017055-72-9 is the registry number for 2-Cyclopentyl-1h-benzo(d)imidazol-5-amine. Offered by: TRC. Available pack sizes: 250mg.
2-cyclopentyl-3H-benzimidazol-5-amine (CAS 1017055-72-9) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: 2-cyclopentyl-3H-benzimidazol-5-amine. InChIKey: JEHWBUFEYZJLHG-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | 2-cyclopentyl-3H-benzimidazol-5-amine |
| InChIKey | JEHWBUFEYZJLHG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC3=C(N2)C=C(C=C3)N |
Computed by PubChem (NCBI)