Products 1017082-14-2
CAS 1017082-14-2 appears in our catalog under these names: (4-Hydroxy-3-(trifluoromethoxy)phenyl)acetone, 95%, (4-Hydroxy-3-(trifluoromethoxy)phenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
1-[4-hydroxy-3-(trifluoromethoxy)phenyl]propan-2-one (CAS 1017082-14-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 1-[4-hydroxy-3-(trifluoromethoxy)phenyl]propan-2-one. InChIKey: HVADKDRSHYJVKY-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-[4-hydroxy-3-(trifluoromethoxy)phenyl]propan-2-one |
| InChIKey | HVADKDRSHYJVKY-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C=C1)O)OC(F)(F)F |
Computed by PubChem (NCBI)