Products 1017112-53-6

CAS 1017112-53-6 is the registry number for 3-(4-Ethoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-ethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1017112-53-6) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 3-(4-ethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: JQDDLABHUQXTBK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4
Molecular weight247.25 g/mol
IUPAC name3-(4-ethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyJQDDLABHUQXTBK-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)C2=NOC(=C2C(=O)O)C

Computed by PubChem (NCBI)