CAS 1017112-56-9 is the registry number for 5-Methyl-3-(3,4,5-trimethoxyphenyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole-4-carboxylic acid (CAS 1017112-56-9) is a chemical compound with the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. IUPAC name: 5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: ZDWCZJURXHVMGP-UHFFFAOYSA-N.
| Molecular formula | C14H15NO6 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | 5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | ZDWCZJURXHVMGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=C(C(=C2)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)