Products 68748-55-0
CAS 68748-55-0 is the registry number for Reductiomycin. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
[4-[(E)-3-[(2-hydroxy-5-oxocyclopenten-1-yl)amino]-3-oxoprop-1-enyl]-2,3-dihydrofuran-2-yl] acetate (CAS 68748-55-0) is a chemical compound with the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. IUPAC name: [4-[(E)-3-[(2-hydroxy-5-oxocyclopenten-1-yl)amino]-3-oxoprop-1-enyl]-2,3-dihydrofuran-2-yl] acetate. InChIKey: VKXPFUZQXMQEDU-GORDUTHDSA-N.
| Molecular formula | C14H15NO6 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | [4-[(E)-3-[(2-hydroxy-5-oxocyclopenten-1-yl)amino]-3-oxoprop-1-enyl]-2,3-dihydrofuran-2-yl] acetate |
| InChIKey | VKXPFUZQXMQEDU-GORDUTHDSA-N |
| SMILES | CC(=O)OC1CC(=CO1)/C=C/C(=O)NC2=C(CCC2=O)O |
Computed by PubChem (NCBI)