Products 1409736-33-9

CAS 1409736-33-9 is the registry number for 5-Methyl-3-(2,4,6-trimethoxyphenyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-3-(2,4,6-trimethoxyphenyl)-1,2-oxazole-4-carboxylic acid (CAS 1409736-33-9) is a chemical compound with the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. IUPAC name: 5-methyl-3-(2,4,6-trimethoxyphenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: QLOQBMBPANBSBX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15NO6
Molecular weight293.27 g/mol
IUPAC name5-methyl-3-(2,4,6-trimethoxyphenyl)-1,2-oxazole-4-carboxylic acid
InChIKeyQLOQBMBPANBSBX-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=C(C=C(C=C2OC)OC)OC)C(=O)O

Computed by PubChem (NCBI)