CAS 17422-56-9 is the registry number for 1,3-Diethyl 2-[(2-nitrophenyl)methylidene]propanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Diethyl 2-[(2-nitrophenyl)methylidene]propanedioate (CAS 17422-56-9) is a chemical compound with the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. IUPAC name: diethyl 2-[(2-nitrophenyl)methylidene]propanedioate. InChIKey: BLHLIGAACQEKRY-UHFFFAOYSA-N.
| Molecular formula | C14H15NO6 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | diethyl 2-[(2-nitrophenyl)methylidene]propanedioate |
| InChIKey | BLHLIGAACQEKRY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC1=CC=CC=C1[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)