Products 1017120-20-5
CAS 1017120-20-5 is the registry number for 6-Amino-3-((3-methylphenyl)methyl)-2,3-dihydro-1,3-benzoxazol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-amino-3-[(3-methylphenyl)methyl]-1,3-benzoxazol-2-one (CAS 1017120-20-5) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: 6-amino-3-[(3-methylphenyl)methyl]-1,3-benzoxazol-2-one. InChIKey: FQVDGJGZWJNQGJ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 6-amino-3-[(3-methylphenyl)methyl]-1,3-benzoxazol-2-one |
| InChIKey | FQVDGJGZWJNQGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C3=C(C=C(C=C3)N)OC2=O |
Computed by PubChem (NCBI)