CAS 1017156-27-2 is the registry number for (4-(1-Benzofuran-2-yl)-1,3-thiazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]methanamine (CAS 1017156-27-2) is a chemical compound with the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. IUPAC name: [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]methanamine. InChIKey: MPATYEYGEXMJGI-UHFFFAOYSA-N.
| Molecular formula | C12H10N2OS |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]methanamine |
| InChIKey | MPATYEYGEXMJGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=CSC(=N3)CN |
Computed by PubChem (NCBI)