CAS 885527-18-4 is the registry number for (5-(1,3-Benzothiazol-2-yl)furan-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[5-(1,3-benzothiazol-2-yl)furan-2-yl]methanamine (CAS 885527-18-4) is a chemical compound with the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. IUPAC name: [5-(1,3-benzothiazol-2-yl)furan-2-yl]methanamine. InChIKey: GQCOQKCMXKBKIE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2OS |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | [5-(1,3-benzothiazol-2-yl)furan-2-yl]methanamine |
| InChIKey | GQCOQKCMXKBKIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(O3)CN |
Computed by PubChem (NCBI)