CAS 101724-84-9 appears in our catalog under these names: 2-(2,2-Dimethylpropanamido)benzoic acid, 95%, 2-Pivalamidobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
2-(2,2-dimethylpropanoylamino)benzoic acid (CAS 101724-84-9) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)benzoic acid. InChIKey: PGCLHEDGEGINOE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)benzoic acid |
| InChIKey | PGCLHEDGEGINOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)