Products 1017277-40-5
CAS 1017277-40-5 appears in our catalog under these names: Sanggenofuran B, Sanggenofuran B. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5-(6-methoxy-1-benzofuran-2-yl)-2-(3-methylbut-2-enyl)benzene-1,3-diol (CAS 1017277-40-5) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: 5-(6-methoxy-1-benzofuran-2-yl)-2-(3-methylbut-2-enyl)benzene-1,3-diol. InChIKey: JCWAZFVQFSNZQI-UHFFFAOYSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 5-(6-methoxy-1-benzofuran-2-yl)-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| InChIKey | JCWAZFVQFSNZQI-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C(C=C1O)C2=CC3=C(O2)C=C(C=C3)OC)O)C |
Computed by PubChem (NCBI)