CAS 10173-53-2 is the registry number for 2-(5-Methyl-1H-1,3-benzodiazol-2-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(6-methyl-1H-benzimidazol-2-yl)aniline (CAS 10173-53-2) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 2-(6-methyl-1H-benzimidazol-2-yl)aniline. InChIKey: LRDGQNBZALRXLA-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(6-methyl-1H-benzimidazol-2-yl)aniline |
| InChIKey | LRDGQNBZALRXLA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3=CC=CC=C3N |
Computed by PubChem (NCBI)