Products 101731-73-1
CAS 101731-73-1 is the registry number for 3-(2-(Benzylamino)-2-oxoethyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-(benzylamino)-2-oxoethyl]-1H-indole-2-carboxylic acid (CAS 101731-73-1) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: 3-[2-(benzylamino)-2-oxoethyl]-1H-indole-2-carboxylic acid. InChIKey: OYMZCCBTSUGDQH-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 3-[2-(benzylamino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| InChIKey | OYMZCCBTSUGDQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)CC2=C(NC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)