Products 956206-42-1

CAS 956206-42-1 is the registry number for 3-(2,5-Dimethoxyphenyl)-1-phenyl-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carbaldehyde (CAS 956206-42-1) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carbaldehyde. InChIKey: CAULXXFRRNKBET-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16N2O3
Molecular weight308.3 g/mol
IUPAC name3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carbaldehyde
InChIKeyCAULXXFRRNKBET-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)OC)C2=NN(C=C2C=O)C3=CC=CC=C3

Computed by PubChem (NCBI)