CAS 133550-37-5 appears in our catalog under these names: Tyrphostin ag 835, 95%, Tyrphostin B44, (+) enantiomer/ 98.8% (existing batch purity), Tyrphostin B44, (+) enantiomer, Tyrphostin AG 835, >98.0%(HPLC), (2E)-2-Cyano-3-(3,4-Dihydroxyphenyl)-N-[(1S)-1-Phenylethyl]-2-Propenamide, 97%, 97%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
(E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide (CAS 133550-37-5) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide. InChIKey: UMGQVUWXNOJOSJ-DGGAMASNSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| InChIKey | UMGQVUWXNOJOSJ-DGGAMASNSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N |
Computed by PubChem (NCBI)