CAS 15180-02-6 appears in our catalog under these names: Amfonelic acid, 95%, Amfonelic Acid, >97.0%(HPLC), 7-Benzyl-1-ethyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid, 97.0%, 97.0%, Amfonelic acid, AMFONELIC ACID, 97%. Offered by: Combi-blocks, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, Get quote.
7-benzyl-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid (CAS 15180-02-6) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: 7-benzyl-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid. InChIKey: WHHHJDGNBVQNAU-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 7-benzyl-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | WHHHJDGNBVQNAU-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)