Products 1017388-31-6
CAS 1017388-31-6 appears in our catalog under these names: 1-(3,4-Dimethoxyphenyl)cyclopropanamine, ≥95%, Cyclopropanamine, 1-(3,4-dimethoxyphenyl)-, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3,4-dimethoxyphenyl)cyclopropan-1-amine (CAS 1017388-31-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)cyclopropan-1-amine. InChIKey: WRRLWQMERKKTLF-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)cyclopropan-1-amine |
| InChIKey | WRRLWQMERKKTLF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)N)OC |
Computed by PubChem (NCBI)