Products 1017539-95-5
CAS 1017539-95-5 is the registry number for 2-Methyl-2-(oxane-4-sulfonyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-methyl-2-(oxan-4-ylsulfonyl)propanoic acid (CAS 1017539-95-5) is a chemical compound with the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. IUPAC name: 2-methyl-2-(oxan-4-ylsulfonyl)propanoic acid. InChIKey: RWDWRTRFMFPMBU-UHFFFAOYSA-N.
| Molecular formula | C9H16O5S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 2-methyl-2-(oxan-4-ylsulfonyl)propanoic acid |
| InChIKey | RWDWRTRFMFPMBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)C1CCOCC1 |
Computed by PubChem (NCBI)
Synonyms:
2-methyl-2-(tetrahydro-pyran-4-sulfonyl)-propionic acid, 2-methyl-2-(oxane-4-sulfonyl)propanoic acid, 2-methyl-2-(oxan-4-ylsulfonyl)propanoic acid, 2-Methyl-2-((tetrahydro-2H-pyran-4-yl)sulfonyl)propanoic acid, RWDWRTRFMFPMBU-UHFFFAOYSA-N, 2-methyl-2-tetrahydropyran-4-ylsulfonyl-propanoic acid