Products 1441640-37-4

CAS 1441640-37-4 is the registry number for 3–(2–(2–(Acetylthio)ethoxy)ethoxy)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3-[2-(2-acetylsulfanylethoxy)ethoxy]propanoic acid (CAS 1441640-37-4) is a chemical compound with the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. IUPAC name: 3-[2-(2-acetylsulfanylethoxy)ethoxy]propanoic acid. InChIKey: CXRDULCWPXRFAD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O5S
Molecular weight236.29 g/mol
IUPAC name3-[2-(2-acetylsulfanylethoxy)ethoxy]propanoic acid
InChIKeyCXRDULCWPXRFAD-UHFFFAOYSA-N
SMILESCC(=O)SCCOCCOCCC(=O)O

Computed by PubChem (NCBI)