CAS 1262832-98-3 is the registry number for (R)-1-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)cyclopropane-1-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonic acid (CAS 1262832-98-3) is a chemical compound with the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. IUPAC name: 1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonic acid. InChIKey: DTYAKZIHBAXOEK-SSDOTTSWSA-N.
| Molecular formula | C9H16O5S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonic acid |
| InChIKey | DTYAKZIHBAXOEK-SSDOTTSWSA-N |
| SMILES | CC1(OC[C@H](O1)CC2(CC2)S(=O)(=O)O)C |
Computed by PubChem (NCBI)