Products 2787522-01-2
CAS 2787522-01-2 is the registry number for Rel-(1s,4s)-1-methyl-4-((methylsulfonyl)oxy)cyclohexane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-4-methylsulfonyloxycyclohexane-1-carboxylic acid (CAS 2787522-01-2) is a chemical compound with the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. IUPAC name: 1-methyl-4-methylsulfonyloxycyclohexane-1-carboxylic acid. InChIKey: SVJXPIBUJKUSDD-UHFFFAOYSA-N.
| Molecular formula | C9H16O5S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 1-methyl-4-methylsulfonyloxycyclohexane-1-carboxylic acid |
| InChIKey | SVJXPIBUJKUSDD-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)OS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)