CAS 101768-64-3 appears in our catalog under these names: 4-((4-Chlorophenyl)sulfonyl)piperidine hydrochloride, 95+%, 4-[(4-Chlorophenyl)sulfonyl]piperidinehydrochloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
4-(4-chlorophenyl)sulfonylpiperidine;hydrochloride (CAS 101768-64-3) is a chemical compound with the molecular formula C11H15Cl2NO2S and a molecular weight of 296.2 g/mol. IUPAC name: 4-(4-chlorophenyl)sulfonylpiperidine;hydrochloride. InChIKey: SJYLTDPLFVFHFC-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)sulfonylpiperidine;hydrochloride |
| InChIKey | SJYLTDPLFVFHFC-UHFFFAOYSA-N |
| SMILES | C1CNCCC1S(=O)(=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)