CAS 2490705-37-6 appears in our catalog under these names: 4-(4-chlorophenyl)tetrahydro-2H-thiopyran-4-amine 1,1-dioxide hydrochloride (1:1), 95%, 4-Amino-4-(4-chlorophenyl)tetrahydro-2H-thiopyran 1,1-dioxide hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
4-(4-chlorophenyl)-1,1-dioxothian-4-amine;hydrochloride (CAS 2490705-37-6) is a chemical compound with the molecular formula C11H15Cl2NO2S and a molecular weight of 296.2 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,1-dioxothian-4-amine;hydrochloride. InChIKey: ZGQMMPRNJBHTJH-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,1-dioxothian-4-amine;hydrochloride |
| InChIKey | ZGQMMPRNJBHTJH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)