CAS 2097936-65-5 is the registry number for 7-(2-Chlorophenyl)-1,4-thiazepane 1,1-dioxide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride (CAS 2097936-65-5) is a chemical compound with the molecular formula C11H15Cl2NO2S and a molecular weight of 296.2 g/mol. IUPAC name: 7-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride. InChIKey: HOWPSWSDFGICPO-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 7-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride |
| InChIKey | HOWPSWSDFGICPO-UHFFFAOYSA-N |
| SMILES | C1CNCCS(=O)(=O)C1C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)