Products 2097936-65-5

CAS 2097936-65-5 is the registry number for 7-(2-Chlorophenyl)-1,4-thiazepane 1,1-dioxide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride (CAS 2097936-65-5) is a chemical compound with the molecular formula C11H15Cl2NO2S and a molecular weight of 296.2 g/mol. IUPAC name: 7-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride. InChIKey: HOWPSWSDFGICPO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15Cl2NO2S
Molecular weight296.2 g/mol
IUPAC name7-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide;hydrochloride
InChIKeyHOWPSWSDFGICPO-UHFFFAOYSA-N
SMILESC1CNCCS(=O)(=O)C1C2=CC=CC=C2Cl.Cl

Computed by PubChem (NCBI)