Products 952942-56-2
CAS 952942-56-2 is the registry number for N-(tert-Butyl)-1-(3,4-dichlorophenyl)methanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-tert-butyl-1-(3,4-dichlorophenyl)methanesulfonamide (CAS 952942-56-2) is a chemical compound with the molecular formula C11H15Cl2NO2S and a molecular weight of 296.2 g/mol. IUPAC name: N-tert-butyl-1-(3,4-dichlorophenyl)methanesulfonamide. InChIKey: UTCNYUAWIZERKR-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | N-tert-butyl-1-(3,4-dichlorophenyl)methanesulfonamide |
| InChIKey | UTCNYUAWIZERKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)