CAS 101769-04-4 appears in our catalog under these names: 3-(Phenylsulfonyl)pyrrolidine, 98+%, 3–(Phenylsulfonyl)pyrrolidine. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g.
3-(benzenesulfonyl)pyrrolidine (CAS 101769-04-4) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 3-(benzenesulfonyl)pyrrolidine. InChIKey: LHGKEGUGTRSIKW-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 3-(benzenesulfonyl)pyrrolidine |
| InChIKey | LHGKEGUGTRSIKW-UHFFFAOYSA-N |
| SMILES | C1CNCC1S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)