Products 1017777-86-4
CAS 1017777-86-4 appears in our catalog under these names: 2,3-Dichloro-6-(trifluoromethyl)phenylacetic acid, 95%, 2-(2,3-Dichloro-6-(trifluoromethyl)phenyl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[2,3-dichloro-6-(trifluoromethyl)phenyl]acetic acid (CAS 1017777-86-4) is a chemical compound with the molecular formula C9H5Cl2F3O2 and a molecular weight of 273.03 g/mol. IUPAC name: 2-[2,3-dichloro-6-(trifluoromethyl)phenyl]acetic acid. InChIKey: LYKFEAIUZGMHGX-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 2-[2,3-dichloro-6-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | LYKFEAIUZGMHGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)CC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)