Products 2166727-47-3
CAS 2166727-47-3 is the registry number for 3,5-Dichloro-4-(2,2,2-trifluoro-ethoxy)-benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,5-dichloro-4-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 2166727-47-3) is a chemical compound with the molecular formula C9H5Cl2F3O2 and a molecular weight of 273.03 g/mol. IUPAC name: 3,5-dichloro-4-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: GQQWCMOHSNIWRV-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 3,5-dichloro-4-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | GQQWCMOHSNIWRV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCC(F)(F)F)Cl)C=O |
Computed by PubChem (NCBI)