Products 2385325-57-3
CAS 2385325-57-3 appears in our catalog under these names: Methyl 2,5-dichloro-3-(trifluoromethyl)benzoate, 95%, Methyl 2,5-dichloro-3-(trifluoromethyl)benzoate, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
Methyl 2,5-dichloro-3-(trifluoromethyl)benzoate (CAS 2385325-57-3) is a chemical compound with the molecular formula C9H5Cl2F3O2 and a molecular weight of 273.03 g/mol. IUPAC name: methyl 2,5-dichloro-3-(trifluoromethyl)benzoate. InChIKey: BKEHOKSELYLOHY-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-(trifluoromethyl)benzoate |
| InChIKey | BKEHOKSELYLOHY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)