Products 2379322-18-4

CAS 2379322-18-4 is the registry number for Methyl 2,6-dichloro-4-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2,6-dichloro-4-(trifluoromethyl)benzoate (CAS 2379322-18-4) is a chemical compound with the molecular formula C9H5Cl2F3O2 and a molecular weight of 273.03 g/mol. IUPAC name: methyl 2,6-dichloro-4-(trifluoromethyl)benzoate. InChIKey: NWFLQLMCYXNLPM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5Cl2F3O2
Molecular weight273.03 g/mol
IUPAC namemethyl 2,6-dichloro-4-(trifluoromethyl)benzoate
InChIKeyNWFLQLMCYXNLPM-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1Cl)C(F)(F)F)Cl

Computed by PubChem (NCBI)