CAS 2379322-18-4 is the registry number for Methyl 2,6-dichloro-4-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 2,6-dichloro-4-(trifluoromethyl)benzoate (CAS 2379322-18-4) is a chemical compound with the molecular formula C9H5Cl2F3O2 and a molecular weight of 273.03 g/mol. IUPAC name: methyl 2,6-dichloro-4-(trifluoromethyl)benzoate. InChIKey: NWFLQLMCYXNLPM-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | methyl 2,6-dichloro-4-(trifluoromethyl)benzoate |
| InChIKey | NWFLQLMCYXNLPM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)