Products 1017778-42-5
CAS 1017778-42-5 is the registry number for 2-Fluoro-4,6-bis(trifluoromethyl)benzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-fluoro-4,6-bis(trifluoromethyl)phenyl]methanol (CAS 1017778-42-5) is a chemical compound with the molecular formula C9H5F7O and a molecular weight of 262.12 g/mol. IUPAC name: [2-fluoro-4,6-bis(trifluoromethyl)phenyl]methanol. InChIKey: PADSZPQGCXBOSE-UHFFFAOYSA-N.
| Molecular formula | C9H5F7O |
|---|---|
| Molecular weight | 262.12 g/mol |
| IUPAC name | [2-fluoro-4,6-bis(trifluoromethyl)phenyl]methanol |
| InChIKey | PADSZPQGCXBOSE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)CO)F)C(F)(F)F |
Computed by PubChem (NCBI)