CAS 71360-30-0 is the registry number for 4-(Heptafluoropropan-2-yl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenol (CAS 71360-30-0) is a chemical compound with the molecular formula C9H5F7O and a molecular weight of 262.12 g/mol. IUPAC name: 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenol. InChIKey: HMCZBEORMIKDPZ-UHFFFAOYSA-N.
| Molecular formula | C9H5F7O |
|---|---|
| Molecular weight | 262.12 g/mol |
| IUPAC name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenol |
| InChIKey | HMCZBEORMIKDPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(C(F)(F)F)F)O |
Computed by PubChem (NCBI)