CAS 1541398-98-4 is the registry number for 2,2,2-Trifluoro-1-(2-fluoro-5-(trifluoromethyl)phenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-[2-fluoro-5-(trifluoromethyl)phenyl]ethanol (CAS 1541398-98-4) is a chemical compound with the molecular formula C9H5F7O and a molecular weight of 262.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-[2-fluoro-5-(trifluoromethyl)phenyl]ethanol. InChIKey: NVBQXIJZNVDWLG-UHFFFAOYSA-N.
| Molecular formula | C9H5F7O |
|---|---|
| Molecular weight | 262.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[2-fluoro-5-(trifluoromethyl)phenyl]ethanol |
| InChIKey | NVBQXIJZNVDWLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(C(F)(F)F)O)F |
Computed by PubChem (NCBI)