CAS 2402-74-6 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-(4-fluorophenyl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,3,3,3-hexafluoro-2-(4-fluorophenyl)propan-2-ol (CAS 2402-74-6) is a chemical compound with the molecular formula C9H5F7O and a molecular weight of 262.12 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(4-fluorophenyl)propan-2-ol. InChIKey: VFFCPASLKRVTCD-UHFFFAOYSA-N.
| Molecular formula | C9H5F7O |
|---|---|
| Molecular weight | 262.12 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(4-fluorophenyl)propan-2-ol |
| InChIKey | VFFCPASLKRVTCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(C(F)(F)F)O)F |
Computed by PubChem (NCBI)