CAS 1017779-05-3 is the registry number for 3'-Chloro-4'-ethoxy-5'-fluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-chloro-4-ethoxy-5-fluorophenyl)ethanone (CAS 1017779-05-3) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: 1-(3-chloro-4-ethoxy-5-fluorophenyl)ethanone. InChIKey: NXUGPYUMPWKWQU-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | 1-(3-chloro-4-ethoxy-5-fluorophenyl)ethanone |
| InChIKey | NXUGPYUMPWKWQU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Cl)C(=O)C)F |
Computed by PubChem (NCBI)