Products 1256479-12-5
CAS 1256479-12-5 appears in our catalog under these names: (4-Chloro-3-fluorophenyl)acetic acid ethyl ester, 95%, (4-Chloro-3-fluorophenyl)acetic acid ethyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 0,25g, 2g.
Ethyl 2-(4-chloro-3-fluorophenyl)acetate (CAS 1256479-12-5) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: ethyl 2-(4-chloro-3-fluorophenyl)acetate. InChIKey: QJLZDNDZQQBARK-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | ethyl 2-(4-chloro-3-fluorophenyl)acetate |
| InChIKey | QJLZDNDZQQBARK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1)Cl)F |
Computed by PubChem (NCBI)